C21H34O5S2 — CID 10646311
methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-thiophen-2-ylsulfanylbutyl)cyclopentyl]heptanoate (PubChem CID 10646311) has the molecular formula C21H34O5S2 and a molecular weight of 430.63 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-thiophen-2-ylsulfanylbutyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-thiophen-2-ylsulfanylbutyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10646311 |
| Molecular Formula | C21H34O5S2 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-4-thiophen-2-ylsulfanylbutyl)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CCC(O)CSc2cccs2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C21H34O5S2/c1-26-20(25)8-5-3-2-4-7-16-17(19(24)13-18(16)23)11-10-15(22)14-28-21-9-6-12-27-21/h6,9,12,15-19,22-24H,2-5,7-8,10-11,13-14H2,1H3/t15?,16-,17-,18+,19-/m1/s1 |
| InChIKey | QPTFLBNNSDFUER-DMTQGNSDSA-N |
| XLogP | 3.85 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|