C25H28Cl2O2 — CID 10646335
(8R,9S,13S,14S,17R)-17-[(2,6-dichlorophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10646335) has the molecular formula C25H28Cl2O2 and a molecular weight of 431.40 g/mol. Its IUPAC name is (8R,9S,13S,14S,17R)-17-[(2,6-dichlorophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17R)-17-[(2,6-dichlorophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10646335 |
| Molecular Formula | C25H28Cl2O2 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (8R,9S,13S,14S,17R)-17-[(2,6-dichlorophenyl)methyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H28Cl2O2/c1-24-11-9-18-17-8-6-16(28)13-15(17)5-7-19(18)21(24)10-12-25(24,29)14-20-22(26)3-2-4-23(20)27/h2-4,6,8,13,18-19,21,28-29H,5,7,9-12,14H2,1H3/t18-,19-,21+,24+,25-/m1/s1 |
| InChIKey | IQFRLLQQBODHNR-KZYPNPOXSA-N |
| XLogP | 6.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |