C27H48O2Si — CID 10646408
(1S,2R,4S,5S)-2-[(5S)-5-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-1,4-dimethyl-8-methylidenebicyclo[3.2.1]octan-2-ol (PubChem CID 10646408) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is (1S,2R,4S,5S)-2-[(5S)-5-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-1,4-dimethyl-8-methylidenebicyclo[3.2.1]octan-2-ol.
| Compound Name | (1S,2R,4S,5S)-2-[(5S)-5-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-1,4-dimethyl-8-methylidenebicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 10646408 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | (1S,2R,4S,5S)-2-[(5S)-5-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-2-methylcyclopenten-1-yl]-1,4-dimethyl-8-methylidenebicyclo[3.2.1]octan-2-ol |
| SMILES | C=C1[C@H]2CC[C@]1(C)[C@@](O)(C1=C(C)CC[C@H]1[C@H](C)CCO[Si](C)(C)C(C)(C)C)C[C@@H]2C |
| InChI | InChI=1S/C27H48O2Si/c1-18(14-16-29-30(9,10)25(5,6)7)23-12-11-19(2)24(23)27(28)17-20(3)22-13-15-26(27,8)21(22)4/h18,20,22-23,28H,4,11-17H2,1-3,5-10H3/t18-,20+,22+,23+,26+,27+/m1/s1 |
| InChIKey | ROGNEDWSVYIBQU-VOLZNPDOSA-N |
| XLogP | 7.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|