C15H24Cl6O — CID 10646415
(E,2R,3S,4R,5S,6S,7R)-2,3,5,6,7,15-hexachloropentadec-14-en-4-ol (PubChem CID 10646415) has the molecular formula C15H24Cl6O and a molecular weight of 433.07 g/mol. Its IUPAC name is (E,2R,3S,4R,5S,6S,7R)-2,3,5,6,7,15-hexachloropentadec-14-en-4-ol.
| Compound Name | (E,2R,3S,4R,5S,6S,7R)-2,3,5,6,7,15-hexachloropentadec-14-en-4-ol |
|---|---|
| PubChem CID | 10646415 |
| Molecular Formula | C15H24Cl6O |
| Molecular Weight | 433.07 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | (E,2R,3S,4R,5S,6S,7R)-2,3,5,6,7,15-hexachloropentadec-14-en-4-ol |
| SMILES | C[C@@H](Cl)[C@@H](Cl)[C@@H](O)[C@H](Cl)[C@@H](Cl)[C@H](Cl)CCCCCC/C=C/Cl |
| InChI | InChI=1S/C15H24Cl6O/c1-10(17)12(19)15(22)14(21)13(20)11(18)8-6-4-2-3-5-7-9-16/h7,9-15,22H,2-6,8H2,1H3/b9-7+/t10-,11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | VQLAUCXPJDIMTF-DBHKVRRXSA-N |
| XLogP | 6.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.07 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|