C20H26N2O5SSi — CID 10646502
methyl 1-(dimethylsulfamoyl)-3-(4-methoxyphenyl)-4-(2-trimethylsilylethynyl)pyrrole-2-carboxylate (PubChem CID 10646502) has the molecular formula C20H26N2O5SSi and a molecular weight of 434.59 g/mol. Its IUPAC name is methyl 1-(dimethylsulfamoyl)-3-(4-methoxyphenyl)-4-(2-trimethylsilylethynyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-(dimethylsulfamoyl)-3-(4-methoxyphenyl)-4-(2-trimethylsilylethynyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10646502 |
| Molecular Formula | C20H26N2O5SSi |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | methyl 1-(dimethylsulfamoyl)-3-(4-methoxyphenyl)-4-(2-trimethylsilylethynyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)c(C#C[Si](C)(C)C)cn1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H26N2O5SSi/c1-21(2)28(24,25)22-14-16(12-13-29(5,6)7)18(19(22)20(23)27-4)15-8-10-17(26-3)11-9-15/h8-11,14H,1-7H3 |
| InChIKey | HPKCQIXNIVVSTJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|