C25H29N3O4 — CID 10646537
(2E)-2-[cyclohexyl-[4-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid (PubChem CID 10646537) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2E)-2-[cyclohexyl-[4-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid.
| Compound Name | (2E)-2-[cyclohexyl-[4-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid |
|---|---|
| PubChem CID | 10646537 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2E)-2-[cyclohexyl-[4-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid |
| SMILES | C/C(=N\OC(c1ccc(OCc2nc3ccccc3n2C)cc1)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C25H29N3O4/c1-17(25(29)30)27-32-24(18-8-4-3-5-9-18)19-12-14-20(15-13-19)31-16-23-26-21-10-6-7-11-22(21)28(23)2/h6-7,10-15,18,24H,3-5,8-9,16H2,1-2H3,(H,29,30)/b27-17+ |
| InChIKey | IUJPEULHUBJJEE-WPWMEQJKSA-N |
| XLogP | 5.25 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|