C21H16N4O7 — CID 10646566
4-[2-(4-nitroanilino)-2-oxoethoxy]-N-(4-nitrophenyl)benzamide (PubChem CID 10646566) has the molecular formula C21H16N4O7 and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-[2-(4-nitroanilino)-2-oxoethoxy]-N-(4-nitrophenyl)benzamide.
| Compound Name | 4-[2-(4-nitroanilino)-2-oxoethoxy]-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 10646566 |
| Molecular Formula | C21H16N4O7 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 4-[2-(4-nitroanilino)-2-oxoethoxy]-N-(4-nitrophenyl)benzamide |
| SMILES | O=C(COc1ccc(C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N4O7/c26-20(22-15-3-7-17(8-4-15)24(28)29)13-32-19-11-1-14(2-12-19)21(27)23-16-5-9-18(10-6-16)25(30)31/h1-12H,13H2,(H,22,26)(H,23,27) |
| InChIKey | VFEBUNYBCTYLAF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|