C21H24O8S — CID 10646579
trimethyl (1E)-7-(benzenesulfonyl)nona-1,7,8-triene-1,5,5-tricarboxylate (PubChem CID 10646579) has the molecular formula C21H24O8S and a molecular weight of 436.48 g/mol. Its IUPAC name is trimethyl (1E)-7-(benzenesulfonyl)nona-1,7,8-triene-1,5,5-tricarboxylate.
| Compound Name | trimethyl (1E)-7-(benzenesulfonyl)nona-1,7,8-triene-1,5,5-tricarboxylate |
|---|---|
| PubChem CID | 10646579 |
| Molecular Formula | C21H24O8S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | trimethyl (1E)-7-(benzenesulfonyl)nona-1,7,8-triene-1,5,5-tricarboxylate |
| SMILES | C=C=C(CC(CC/C=C/C(=O)OC)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O8S/c1-5-16(30(25,26)17-11-7-6-8-12-17)15-21(19(23)28-3,20(24)29-4)14-10-9-13-18(22)27-2/h6-9,11-13H,1,10,14-15H2,2-4H3/b13-9+ |
| InChIKey | WGBFWIQVHRUSLP-UKTHLTGXSA-N |
| XLogP | 2.36 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|