About 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride
2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride (PubChem CID 106466331) has the molecular formula C7H7BrClN5O4S3
and a molecular weight of 436.72 g/mol. Its IUPAC name is 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 106466331 |
| Molecular Formula | C7H7BrClN5O4S3 |
| Molecular Weight | 436.72 g/mol |
| Exact Mass | 434.85 |
| IUPAC Name | 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| SMILES | Cc1nc(NS(=O)(=O)c2c(Br)nnn2C)sc1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H7BrClN5O4S3/c1-3-6(20(9,15)16)19-7(10-3)12-21(17,18)5-4(8)11-13-14(5)2/h1-2H3,(H,10,12) |
| InChIKey | UEBNHIQQQPASHB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.72 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride (CID 106466331) is 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride is Cc1nc(NS(=O)(=O)c2c(Br)nnn2C)sc1S(=O)(=O)Cl.
What is the InChIKey of 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is UEBNHIQQQPASHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrClN5O4S3/c1-3-6(20(9,15)16)19-7(10-3)12-21(17,18)5-4(8)11-13-14(5)2/h1-2H3,(H,10,12).
What are the key properties of 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride?
2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 436.72 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-3-methyltriazol-4-yl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 106466331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).