C11H13Br2N5O — CID 106466623
[(3-bromo-4-methoxyphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]hydrazine (PubChem CID 106466623) has the molecular formula C11H13Br2N5O and a molecular weight of 391.07 g/mol. Its IUPAC name is [(3-bromo-4-methoxyphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]hydrazine.
| Compound Name | [(3-bromo-4-methoxyphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106466623 |
| Molecular Formula | C11H13Br2N5O |
| Molecular Weight | 391.07 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | [(3-bromo-4-methoxyphenyl)-(5-bromo-3-methyltriazol-4-yl)methyl]hydrazine |
| SMILES | COc1ccc(C(NN)c2c(Br)nnn2C)cc1Br |
| InChI | InChI=1S/C11H13Br2N5O/c1-18-10(11(13)16-17-18)9(15-14)6-3-4-8(19-2)7(12)5-6/h3-5,9,15H,14H2,1-2H3 |
| InChIKey | QFBOOCSYZGBNOK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.07 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|