C10H10BrCl2N5 — CID 106466629
[(5-bromo-3-methyltriazol-4-yl)-(2,3-dichlorophenyl)methyl]hydrazine (PubChem CID 106466629) has the molecular formula C10H10BrCl2N5 and a molecular weight of 351.04 g/mol. Its IUPAC name is [(5-bromo-3-methyltriazol-4-yl)-(2,3-dichlorophenyl)methyl]hydrazine.
| Compound Name | [(5-bromo-3-methyltriazol-4-yl)-(2,3-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106466629 |
| Molecular Formula | C10H10BrCl2N5 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | [(5-bromo-3-methyltriazol-4-yl)-(2,3-dichlorophenyl)methyl]hydrazine |
| SMILES | Cn1nnc(Br)c1C(NN)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10BrCl2N5/c1-18-9(10(11)16-17-18)8(15-14)5-3-2-4-6(12)7(5)13/h2-4,8,15H,14H2,1H3 |
| InChIKey | KRRFHOXLMWZYFZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|