About 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide
5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide (PubChem CID 106467673) has the molecular formula C11H11BrF2N4O2S
and a molecular weight of 381.20 g/mol. Its IUPAC name is 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide |
| PubChem CID | 106467673 |
| Molecular Formula | C11H11BrF2N4O2S |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1c(Br)nnn1C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11BrF2N4O2S/c1-6(7-3-4-8(13)9(14)5-7)16-21(19,20)11-10(12)15-17-18(11)2/h3-6,16H,1-2H3 |
| InChIKey | JPRADPYCCXCETD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide?
The IUPAC name of 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide (CID 106467673) is 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide?
The canonical SMILES for 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide is CC(NS(=O)(=O)c1c(Br)nnn1C)c1ccc(F)c(F)c1.
What is the InChIKey of 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide?
The InChIKey is JPRADPYCCXCETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF2N4O2S/c1-6(7-3-4-8(13)9(14)5-7)16-21(19,20)11-10(12)15-17-18(11)2/h3-6,16H,1-2H3.
What are the key properties of 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide?
5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide has a molecular weight of 381.20 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[1-(3,4-difluorophenyl)ethyl]-3-methyltriazole-4-sulfonamide is sourced from PubChem (CID 106467673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).