About 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide
5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide (PubChem CID 106468008) has the molecular formula C7H10BrF3N4O3S
and a molecular weight of 367.15 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide |
| PubChem CID | 106468008 |
| Molecular Formula | C7H10BrF3N4O3S |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 365.96 |
| IUPAC Name | 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C7H10BrF3N4O3S/c1-15-6(5(8)13-14-15)19(16,17)12-2-3-18-4-7(9,10)11/h12H,2-4H2,1H3 |
| InChIKey | QFRZYRJBUDUJDF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide?
The IUPAC name of 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide (CID 106468008) is 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide.
What is the SMILES notation for 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide?
The canonical SMILES for 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide is Cn1nnc(Br)c1S(=O)(=O)NCCOCC(F)(F)F.
What is the InChIKey of 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide?
The InChIKey is QFRZYRJBUDUJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrF3N4O3S/c1-15-6(5(8)13-14-15)19(16,17)12-2-3-18-4-7(9,10)11/h12H,2-4H2,1H3.
What are the key properties of 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide?
5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide has a molecular weight of 367.15 g/mol, XLogP of 0.43, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]triazole-4-sulfonamide is sourced from PubChem (CID 106468008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).