About 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one
2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one (PubChem CID 106468607) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one.
Analyze 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one?
The IUPAC name of 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one (CID 106468607) is 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one.
What is the SMILES notation for 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one?
The canonical SMILES for 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one is CCCN1N=C2CCOCC2C1=O.
What is the InChIKey of 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one?
The InChIKey is HPPKFAPYMCSAEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-4-11-9(12)7-6-13-5-3-8(7)10-11/h7H,2-6H2,1H3.
What are the key properties of 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one?
2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one has a molecular weight of 182.22 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-3a,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-one is sourced from PubChem (CID 106468607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).