C13H19NO2S — CID 106468815
3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]oxan-4-one (PubChem CID 106468815) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]oxan-4-one.
| Compound Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]oxan-4-one |
|---|---|
| PubChem CID | 106468815 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]oxan-4-one |
| SMILES | CC(C)(C)c1csc(CC2COCCC2=O)n1 |
| InChI | InChI=1S/C13H19NO2S/c1-13(2,3)11-8-17-12(14-11)6-9-7-16-5-4-10(9)15/h8-9H,4-7H2,1-3H3 |
| InChIKey | KJPQFNYPZQGDAT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |