C13H22ClN3O — CID 106468968
3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]oxan-4-amine (PubChem CID 106468968) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]oxan-4-amine.
| Compound Name | 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 106468968 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 3-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]oxan-4-amine |
| SMILES | CCc1nn(CC)c(CC2COCCC2N)c1Cl |
| InChI | InChI=1S/C13H22ClN3O/c1-3-11-13(14)12(17(4-2)16-11)7-9-8-18-6-5-10(9)15/h9-10H,3-8,15H2,1-2H3 |
| InChIKey | XSHXGFBXANLUGO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |