C22H44O5Si2 — CID 10646971
(5R)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]oxolan-2-yl]oxolan-2-one (PubChem CID 10646971) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (5R)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]oxolan-2-yl]oxolan-2-one.
| Compound Name | (5R)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]oxolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 10646971 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (5R)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]oxolan-2-yl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]([C@H]2CCC(=O)O2)O1 |
| InChI | InChI=1S/C22H44O5Si2/c1-21(2,3)28(7,8)24-15-19(27-29(9,10)22(4,5)6)18-12-11-16(25-18)17-13-14-20(23)26-17/h16-19H,11-15H2,1-10H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | NQFLOBRLBIHDAF-NCXUSEDFSA-N |
| XLogP | 5.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|