C14H14F2O4 — CID 106470058
3-(2,2-difluoro-2-phenylethyl)-4-oxooxane-3-carboxylic acid (PubChem CID 106470058) has the molecular formula C14H14F2O4 and a molecular weight of 284.26 g/mol. Its IUPAC name is 3-(2,2-difluoro-2-phenylethyl)-4-oxooxane-3-carboxylic acid.
| Compound Name | 3-(2,2-difluoro-2-phenylethyl)-4-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 106470058 |
| Molecular Formula | C14H14F2O4 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-(2,2-difluoro-2-phenylethyl)-4-oxooxane-3-carboxylic acid |
| SMILES | O=C(O)C1(CC(F)(F)c2ccccc2)COCCC1=O |
| InChI | InChI=1S/C14H14F2O4/c15-14(16,10-4-2-1-3-5-10)8-13(12(18)19)9-20-7-6-11(13)17/h1-5H,6-9H2,(H,18,19) |
| InChIKey | OJLANEIBTOSWMG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|