About 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide
4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide (PubChem CID 10647145) has the molecular formula C22H16N4O3S2
and a molecular weight of 448.53 g/mol. Its IUPAC name is 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide |
| PubChem CID | 10647145 |
| Molecular Formula | C22H16N4O3S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide |
| SMILES | O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)Nc2ccnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16N4O3S2/c27-22-19-8-4-5-9-20(19)30-26(22)17-10-12-18(13-11-17)31(28,29)24-21-14-15-23-25(21)16-6-2-1-3-7-16/h1-15,24H |
| InChIKey | ARVQXVVOGZAEQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The IUPAC name of 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide (CID 10647145) is 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide.
What is the SMILES notation for 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The canonical SMILES for 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide is O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)Nc2ccnn2-c2ccccc2)cc1.
What is the InChIKey of 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
The InChIKey is ARVQXVVOGZAEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O3S2/c27-22-19-8-4-5-9-20(19)30-26(22)17-10-12-18(13-11-17)31(28,29)24-21-14-15-23-25(21)16-6-2-1-3-7-16/h1-15,24H.
What are the key properties of 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide?
4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide has a molecular weight of 448.53 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-oxo-1,2-benzothiazol-2-yl)-N-(2-phenylpyrazol-3-yl)benzenesulfonamide is sourced from PubChem (CID 10647145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).