C23H29FO4SSi — CID 10647155
[(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxythiolan-2-yl] acetate (PubChem CID 10647155) has the molecular formula C23H29FO4SSi and a molecular weight of 448.63 g/mol. Its IUPAC name is [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxythiolan-2-yl] acetate.
| Compound Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxythiolan-2-yl] acetate |
|---|---|
| PubChem CID | 10647155 |
| Molecular Formula | C23H29FO4SSi |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(3S,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-4-hydroxythiolan-2-yl] acetate |
| SMILES | CC(=O)OC1S[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C23H29FO4SSi/c1-16(25)28-22-20(24)21(26)19(29-22)15-27-30(23(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-22,26H,15H2,1-4H3/t19-,20+,21-,22?/m1/s1 |
| InChIKey | MPRFVNXTOLZVBC-NJDFBWEVSA-N |
| XLogP | 3.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|