About 4-bromo-3-heptyloxane
4-bromo-3-heptyloxane (PubChem CID 106471599) has the molecular formula C12H23BrO
and a molecular weight of 263.22 g/mol. Its IUPAC name is 4-bromo-3-heptyloxane.
Molecular Properties
| Compound Name | 4-bromo-3-heptyloxane |
| PubChem CID | 106471599 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-bromo-3-heptyloxane |
| SMILES | CCCCCCCC1COCCC1Br |
| InChI | InChI=1S/C12H23BrO/c1-2-3-4-5-6-7-11-10-14-9-8-12(11)13/h11-12H,2-10H2,1H3 |
| InChIKey | UMRAKLJOPFCSHV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-heptyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-heptyloxane?
The IUPAC name of 4-bromo-3-heptyloxane (CID 106471599) is 4-bromo-3-heptyloxane.
What is the SMILES notation for 4-bromo-3-heptyloxane?
The canonical SMILES for 4-bromo-3-heptyloxane is CCCCCCCC1COCCC1Br.
What is the InChIKey of 4-bromo-3-heptyloxane?
The InChIKey is UMRAKLJOPFCSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO/c1-2-3-4-5-6-7-11-10-14-9-8-12(11)13/h11-12H,2-10H2,1H3.
What are the key properties of 4-bromo-3-heptyloxane?
4-bromo-3-heptyloxane has a molecular weight of 263.22 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-heptyloxane is sourced from PubChem (CID 106471599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).