C13H16ClN3O — CID 106471818
5-tert-butyl-8-chloro-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 106471818) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-tert-butyl-8-chloro-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 5-tert-butyl-8-chloro-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 106471818 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-tert-butyl-8-chloro-11-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | CC(C)(C)c1cc2nc3c(c(Cl)n2n1)COCC3 |
| InChI | InChI=1S/C13H16ClN3O/c1-13(2,3)10-6-11-15-9-4-5-18-7-8(9)12(14)17(11)16-10/h6H,4-5,7H2,1-3H3 |
| InChIKey | OAGUSZWSSIBQLS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |