C29H30N4O — CID 10647216
N-[6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinolin-10-yl]-2-pyridin-2-ylacetamide (PubChem CID 10647216) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinolin-10-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinolin-10-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 10647216 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[6-(4-tert-butylphenyl)-3,4-dihydro-2H-pyrimido[2,1-a]isoquinolin-10-yl]-2-pyridin-2-ylacetamide |
| SMILES | CC(C)(C)c1ccc(C2=Cc3ccc(NC(=O)Cc4ccccn4)cc3C3=NCCCN23)cc1 |
| InChI | InChI=1S/C29H30N4O/c1-29(2,3)22-11-8-20(9-12-22)26-17-21-10-13-24(18-25(21)28-31-15-6-16-33(26)28)32-27(34)19-23-7-4-5-14-30-23/h4-5,7-14,17-18H,6,15-16,19H2,1-3H3,(H,32,34) |
| InChIKey | HFLSFJBXXQYYBE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|