C21H19ClN8O2 — CID 10647227
1-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(3-chlorophenyl)urea (PubChem CID 10647227) has the molecular formula C21H19ClN8O2 and a molecular weight of 450.89 g/mol. Its IUPAC name is 1-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 10647227 |
| Molecular Formula | C21H19ClN8O2 |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(3-chlorophenyl)urea |
| SMILES | CCCCn1cc2c(nc(NC(=O)Nc3cccc(Cl)c3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H19ClN8O2/c1-2-3-9-29-12-15-17(27-29)25-20(26-21(31)23-14-7-4-6-13(22)11-14)30-19(15)24-18(28-30)16-8-5-10-32-16/h4-8,10-12H,2-3,9H2,1H3,(H2,23,25,26,27,31) |
| InChIKey | OIVZKXGLPGFSTR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |