C9H13N3O — CID 106472396
N-ethyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-amine (PubChem CID 106472396) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-ethyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-amine.
| Compound Name | N-ethyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106472396 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-ethyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-amine |
| SMILES | CCNc1ncnc2c1COCC2 |
| InChI | InChI=1S/C9H13N3O/c1-2-10-9-7-5-13-4-3-8(7)11-6-12-9/h6H,2-5H2,1H3,(H,10,11,12) |
| InChIKey | TXSBJYPMGCQXLN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |