C10H16N4O — CID 106473388
(2-propyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl)hydrazine (PubChem CID 106473388) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-propyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-propyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 106473388 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (2-propyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl)hydrazine |
| SMILES | CCCc1nc2c(c(NN)n1)COCC2 |
| InChI | InChI=1S/C10H16N4O/c1-2-3-9-12-8-4-5-15-6-7(8)10(13-9)14-11/h2-6,11H2,1H3,(H,12,13,14) |
| InChIKey | BKADGKRHVFEWGE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|