C11H16N2O5S — CID 106474192
3-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol (PubChem CID 106474192) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol.
| Compound Name | 3-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
|---|---|
| PubChem CID | 106474192 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-[3-(1,1-dioxothiolan-3-yl)-1,2,4-oxadiazol-5-yl]oxan-4-ol |
| SMILES | O=S1(=O)CCC(c2noc(C3COCCC3O)n2)C1 |
| InChI | InChI=1S/C11H16N2O5S/c14-9-1-3-17-5-8(9)11-12-10(13-18-11)7-2-4-19(15,16)6-7/h7-9,14H,1-6H2 |
| InChIKey | NHUNPFCEMRAWBI-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |