About 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine
3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine (PubChem CID 106474530) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine.
Molecular Properties
| Compound Name | 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine |
| PubChem CID | 106474530 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine |
| SMILES | CCOCc1noc(C2COCCC2NC)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-3-15-7-10-13-11(17-14-10)8-6-16-5-4-9(8)12-2/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | IXFWIYRMPPQLFR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine?
The IUPAC name of 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine (CID 106474530) is 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine.
What is the SMILES notation for 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine?
The canonical SMILES for 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine is CCOCc1noc(C2COCCC2NC)n1.
What is the InChIKey of 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine?
The InChIKey is IXFWIYRMPPQLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-3-15-7-10-13-11(17-14-10)8-6-16-5-4-9(8)12-2/h8-9,12H,3-7H2,1-2H3.
What are the key properties of 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine?
3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine has a molecular weight of 241.29 g/mol, XLogP of 0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(ethoxymethyl)-1,2,4-oxadiazol-5-yl]-N-methyloxan-4-amine is sourced from PubChem (CID 106474530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).