C27H27N3O4 — CID 10647510
ethyl 5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-2-carboxylate (PubChem CID 10647510) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl 5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10647510 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(CCN3C(=O)c4ccccc4C3=O)cc2c1C1=CCN(C)CC1 |
| InChI | InChI=1S/C27H27N3O4/c1-3-34-27(33)24-23(18-11-13-29(2)14-12-18)21-16-17(8-9-22(21)28-24)10-15-30-25(31)19-6-4-5-7-20(19)26(30)32/h4-9,11,16,28H,3,10,12-15H2,1-2H3 |
| InChIKey | MSALZTSJFZLEPL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|