C13H22N2OS — CID 106475219
2-(1-ethoxybutyl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106475219) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-(1-ethoxybutyl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(1-ethoxybutyl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475219 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(1-ethoxybutyl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(C(CCC)OCC)[nH]1 |
| InChI | InChI=1S/C13H22N2OS/c1-4-7-10-9-12(17)15-13(14-10)11(8-5-2)16-6-3/h9,11H,4-8H2,1-3H3,(H,14,15,17) |
| InChIKey | UWLJSPVKEMMTSU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|