About 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione
2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106475316) has the molecular formula C12H18N2S3
and a molecular weight of 286.49 g/mol. Its IUPAC name is 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| PubChem CID | 106475316 |
| Molecular Formula | C12H18N2S3 |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | CC(C)c1cc(=S)nc(C2SCCSC2C)[nH]1 |
| InChI | InChI=1S/C12H18N2S3/c1-7(2)9-6-10(15)14-12(13-9)11-8(3)16-4-5-17-11/h6-8,11H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | CZDLWQKGUOMTOH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione?
The IUPAC name of 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione (CID 106475316) is 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione?
The canonical SMILES for 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione is CC(C)c1cc(=S)nc(C2SCCSC2C)[nH]1.
What is the InChIKey of 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione?
The InChIKey is CZDLWQKGUOMTOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2S3/c1-7(2)9-6-10(15)14-12(13-9)11-8(3)16-4-5-17-11/h6-8,11H,4-5H2,1-3H3,(H,13,14,15).
What are the key properties of 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione?
2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione has a molecular weight of 286.49 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,4-dithian-2-yl)-6-propan-2-yl-1H-pyrimidine-4-thione is sourced from PubChem (CID 106475316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).