C16H26N2OS — CID 106475432
2-(1-methoxy-4,4-dimethylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106475432) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-(1-methoxy-4,4-dimethylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2-(1-methoxy-4,4-dimethylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475432 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-(1-methoxy-4,4-dimethylcyclohexyl)-6-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | COC1(c2nc(=S)cc(C(C)C)[nH]2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H26N2OS/c1-11(2)12-10-13(20)18-14(17-12)16(19-5)8-6-15(3,4)7-9-16/h10-11H,6-9H2,1-5H3,(H,17,18,20) |
| InChIKey | KVAYWZYSOCTDMA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|