C12H17N3OS — CID 106475610
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106475610) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475610 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-methyl-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(C2CN3CCCC3CO2)[nH]1 |
| InChI | InChI=1S/C12H17N3OS/c1-8-5-11(17)14-12(13-8)10-6-15-4-2-3-9(15)7-16-10/h5,9-10H,2-4,6-7H2,1H3,(H,13,14,17) |
| InChIKey | GXDFGEZESYCUHY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|