C13H19N3S — CID 106475616
6-methyl-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106475616) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 6-methyl-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475616 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 6-methyl-2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(C2CC3CCC(C2)N3C)[nH]1 |
| InChI | InChI=1S/C13H19N3S/c1-8-5-12(17)15-13(14-8)9-6-10-3-4-11(7-9)16(10)2/h5,9-11H,3-4,6-7H2,1-2H3,(H,14,15,17) |
| InChIKey | QPXHBAZEEUUAEC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|