C22H20ClF5N2O — CID 10647579
5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-(2,3,4,5,6-pentafluorophenyl)pentanenitrile (PubChem CID 10647579) has the molecular formula C22H20ClF5N2O and a molecular weight of 458.86 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-(2,3,4,5,6-pentafluorophenyl)pentanenitrile.
| Compound Name | 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-(2,3,4,5,6-pentafluorophenyl)pentanenitrile |
|---|---|
| PubChem CID | 10647579 |
| Molecular Formula | C22H20ClF5N2O |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-(2,3,4,5,6-pentafluorophenyl)pentanenitrile |
| SMILES | N#CC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H20ClF5N2O/c23-15-5-3-14(4-6-15)22(31)7-10-30(11-8-22)9-1-2-13(12-29)16-17(24)19(26)21(28)20(27)18(16)25/h3-6,13,31H,1-2,7-11H2 |
| InChIKey | SFINWUNHLAYVIS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|