About 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione
6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione (PubChem CID 106475814) has the molecular formula C16H26N2S
and a molecular weight of 278.46 g/mol. Its IUPAC name is 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione |
| PubChem CID | 106475814 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione |
| SMILES | CC1(C)CCC(c2nc(=S)cc(C(C)(C)C)[nH]2)CC1 |
| InChI | InChI=1S/C16H26N2S/c1-15(2,3)12-10-13(19)18-14(17-12)11-6-8-16(4,5)9-7-11/h10-11H,6-9H2,1-5H3,(H,17,18,19) |
| InChIKey | HGOARTCQRRNCPJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione?
The IUPAC name of 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione (CID 106475814) is 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione.
What is the SMILES notation for 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione?
The canonical SMILES for 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione is CC1(C)CCC(c2nc(=S)cc(C(C)(C)C)[nH]2)CC1.
What is the InChIKey of 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione?
The InChIKey is HGOARTCQRRNCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2S/c1-15(2,3)12-10-13(19)18-14(17-12)11-6-8-16(4,5)9-7-11/h10-11H,6-9H2,1-5H3,(H,17,18,19).
What are the key properties of 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione?
6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione has a molecular weight of 278.46 g/mol, XLogP of 5.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-(4,4-dimethylcyclohexyl)-1H-pyrimidine-4-thione is sourced from PubChem (CID 106475814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).