C13H20N2S3 — CID 106475819
6-tert-butyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106475819) has the molecular formula C13H20N2S3 and a molecular weight of 300.52 g/mol. Its IUPAC name is 6-tert-butyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475819 |
| Molecular Formula | C13H20N2S3 |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6-tert-butyl-2-(3-methyl-1,4-dithian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CC1SCCSC1c1nc(=S)cc(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C13H20N2S3/c1-8-11(18-6-5-17-8)12-14-9(13(2,3)4)7-10(16)15-12/h7-8,11H,5-6H2,1-4H3,(H,14,15,16) |
| InChIKey | JSHGHJRQEAVOJY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|