C14H24N2OS — CID 106475851
6-tert-butyl-2-(2-ethoxybutan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106475851) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 6-tert-butyl-2-(2-ethoxybutan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(2-ethoxybutan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475851 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 6-tert-butyl-2-(2-ethoxybutan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCOC(C)(CC)c1nc(=S)cc(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H24N2OS/c1-7-14(6,17-8-2)12-15-10(13(3,4)5)9-11(18)16-12/h9H,7-8H2,1-6H3,(H,15,16,18) |
| InChIKey | BKXWZWRADDTEFE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|