C13H6F5N3O4S3 — CID 10647590
6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1,3-benzothiazole-2-sulfonamide (PubChem CID 10647590) has the molecular formula C13H6F5N3O4S3 and a molecular weight of 459.40 g/mol. Its IUPAC name is 6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10647590 |
| Molecular Formula | C13H6F5N3O4S3 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.94 |
| IUPAC Name | 6-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc(NS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2s1 |
| InChI | InChI=1S/C13H6F5N3O4S3/c14-7-8(15)10(17)12(11(18)9(7)16)28(24,25)21-4-1-2-5-6(3-4)26-13(20-5)27(19,22)23/h1-3,21H,(H2,19,22,23) |
| InChIKey | HJEXWDTYGATKLK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|