C15H26N2OS — CID 106475935
6-tert-butyl-2-(3-ethoxypentan-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106475935) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is 6-tert-butyl-2-(3-ethoxypentan-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(3-ethoxypentan-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475935 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 6-tert-butyl-2-(3-ethoxypentan-3-yl)-1H-pyrimidine-4-thione |
| SMILES | CCOC(CC)(CC)c1nc(=S)cc(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C15H26N2OS/c1-7-15(8-2,18-9-3)13-16-11(14(4,5)6)10-12(19)17-13/h10H,7-9H2,1-6H3,(H,16,17,19) |
| InChIKey | DBEKOTBJFBRKNS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|