C13H22N2OS — CID 106475940
6-tert-butyl-2-(2-methoxybutan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106475940) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 6-tert-butyl-2-(2-methoxybutan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(2-methoxybutan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475940 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-tert-butyl-2-(2-methoxybutan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCC(C)(OC)c1nc(=S)cc(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C13H22N2OS/c1-7-13(5,16-6)11-14-9(12(2,3)4)8-10(17)15-11/h8H,7H2,1-6H3,(H,14,15,17) |
| InChIKey | HUPGIOOTCSIYTO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|