C14H23N3OS — CID 106476010
6-tert-butyl-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106476010) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 6-tert-butyl-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476010 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 6-tert-butyl-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCN1CCOC(c2nc(=S)cc(C(C)(C)C)[nH]2)C1 |
| InChI | InChI=1S/C14H23N3OS/c1-5-17-6-7-18-10(9-17)13-15-11(14(2,3)4)8-12(19)16-13/h8,10H,5-7,9H2,1-4H3,(H,15,16,19) |
| InChIKey | CTXLWVLVTSQUIW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|