About 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione
2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione (PubChem CID 106476095) has the molecular formula C18H26N2S
and a molecular weight of 302.49 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione |
| PubChem CID | 106476095 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C23CC4CC(C)(CC(C)(C4)C2)C3)[nH]1 |
| InChI | InChI=1S/C18H26N2S/c1-4-13-5-14(21)20-15(19-13)18-8-12-6-16(2,10-18)9-17(3,7-12)11-18/h5,12H,4,6-11H2,1-3H3,(H,19,20,21) |
| InChIKey | IPGRGGHYLAYTOT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione?
The IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione (CID 106476095) is 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione.
What is the SMILES notation for 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione?
The canonical SMILES for 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione is CCc1cc(=S)nc(C23CC4CC(C)(CC(C)(C4)C2)C3)[nH]1.
What is the InChIKey of 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione?
The InChIKey is IPGRGGHYLAYTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2S/c1-4-13-5-14(21)20-15(19-13)18-8-12-6-16(2,10-18)9-17(3,7-12)11-18/h5,12H,4,6-11H2,1-3H3,(H,19,20,21).
What are the key properties of 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione?
2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione has a molecular weight of 302.49 g/mol, XLogP of 4.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-adamantyl)-6-ethyl-1H-pyrimidine-4-thione is sourced from PubChem (CID 106476095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).