C10H15N3OS — CID 106476133
6-ethyl-2-morpholin-4-yl-1H-pyrimidine-4-thione (PubChem CID 106476133) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 6-ethyl-2-morpholin-4-yl-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2-morpholin-4-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476133 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 6-ethyl-2-morpholin-4-yl-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(N2CCOCC2)[nH]1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-8-7-9(15)12-10(11-8)13-3-5-14-6-4-13/h7H,2-6H2,1H3,(H,11,12,15) |
| InChIKey | HNFRXJAKKDUNTJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|