C22H19ClFN3O5 — CID 10647617
ethyl 5-(benzylamino)-8-chloro-1-cyclopropyl-7-fluoro-6-nitro-4-oxoquinoline-3-carboxylate (PubChem CID 10647617) has the molecular formula C22H19ClFN3O5 and a molecular weight of 459.86 g/mol. Its IUPAC name is ethyl 5-(benzylamino)-8-chloro-1-cyclopropyl-7-fluoro-6-nitro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 5-(benzylamino)-8-chloro-1-cyclopropyl-7-fluoro-6-nitro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10647617 |
| Molecular Formula | C22H19ClFN3O5 |
| Molecular Weight | 459.86 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | ethyl 5-(benzylamino)-8-chloro-1-cyclopropyl-7-fluoro-6-nitro-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CC2)c2c(Cl)c(F)c([N+](=O)[O-])c(NCc3ccccc3)c2c1=O |
| InChI | InChI=1S/C22H19ClFN3O5/c1-2-32-22(29)14-11-26(13-8-9-13)19-15(21(14)28)18(20(27(30)31)17(24)16(19)23)25-10-12-6-4-3-5-7-12/h3-7,11,13,25H,2,8-10H2,1H3 |
| InChIKey | NNIIOZSEIAVHFK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|