C11H16N2OS — CID 106476204
6-ethyl-2-(oxan-3-yl)-1H-pyrimidine-4-thione (PubChem CID 106476204) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 6-ethyl-2-(oxan-3-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-ethyl-2-(oxan-3-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476204 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 6-ethyl-2-(oxan-3-yl)-1H-pyrimidine-4-thione |
| SMILES | CCc1cc(=S)nc(C2CCCOC2)[nH]1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-9-6-10(15)13-11(12-9)8-4-3-5-14-7-8/h6,8H,2-5,7H2,1H3,(H,12,13,15) |
| InChIKey | JJJBWUVLZBWIFM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|