About 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione
2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione (PubChem CID 106476359) has the molecular formula C8H10F2N2OS
and a molecular weight of 220.24 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione.
Molecular Properties
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione |
| PubChem CID | 106476359 |
| Molecular Formula | C8H10F2N2OS |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione |
| SMILES | FC(F)COCCc1nccc(=S)[nH]1 |
| InChI | InChI=1S/C8H10F2N2OS/c9-6(10)5-13-4-2-7-11-3-1-8(14)12-7/h1,3,6H,2,4-5H2,(H,11,12,14) |
| InChIKey | WGZGANQCVHDGIF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The IUPAC name of 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione (CID 106476359) is 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione.
What is the SMILES notation for 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The canonical SMILES for 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione is FC(F)COCCc1nccc(=S)[nH]1.
What is the InChIKey of 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
The InChIKey is WGZGANQCVHDGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2OS/c9-6(10)5-13-4-2-7-11-3-1-8(14)12-7/h1,3,6H,2,4-5H2,(H,11,12,14).
What are the key properties of 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione?
2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione has a molecular weight of 220.24 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidine-6-thione is sourced from PubChem (CID 106476359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).