About 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione
2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione (PubChem CID 106476415) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione.
Molecular Properties
| Compound Name | 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione |
| PubChem CID | 106476415 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione |
| SMILES | CCOC(c1nccc(=S)[nH]1)C(C)(C)C |
| InChI | InChI=1S/C11H18N2OS/c1-5-14-9(11(2,3)4)10-12-7-6-8(15)13-10/h6-7,9H,5H2,1-4H3,(H,12,13,15) |
| InChIKey | LOJPIKSRZGZLPD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione?
The IUPAC name of 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione (CID 106476415) is 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione.
What is the SMILES notation for 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione?
The canonical SMILES for 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione is CCOC(c1nccc(=S)[nH]1)C(C)(C)C.
What is the InChIKey of 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione?
The InChIKey is LOJPIKSRZGZLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-5-14-9(11(2,3)4)10-12-7-6-8(15)13-10/h6-7,9H,5H2,1-4H3,(H,12,13,15).
What are the key properties of 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione?
2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione has a molecular weight of 226.34 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethoxy-2,2-dimethylpropyl)-1H-pyrimidine-6-thione is sourced from PubChem (CID 106476415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).