C22H24N2O7S — CID 10647648
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 10647648) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10647648 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | O=C(CCCCCNC(=O)OCc1ccccc1)OCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C22H24N2O7S/c25-20(31-16-24-21(26)18-11-6-7-12-19(18)32(24,28)29)13-5-2-8-14-23-22(27)30-15-17-9-3-1-4-10-17/h1,3-4,6-7,9-12H,2,5,8,13-16H2,(H,23,27) |
| InChIKey | JIVPYEMHOZUCCM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|