About 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione
2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione (PubChem CID 106476564) has the molecular formula C8H10N2S3
and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione.
Molecular Properties
| Compound Name | 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione |
| PubChem CID | 106476564 |
| Molecular Formula | C8H10N2S3 |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione |
| SMILES | S=c1ccnc(C2CSCCS2)[nH]1 |
| InChI | InChI=1S/C8H10N2S3/c11-7-1-2-9-8(10-7)6-5-12-3-4-13-6/h1-2,6H,3-5H2,(H,9,10,11) |
| InChIKey | UVOPBBSJAZHSBJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione?
The IUPAC name of 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione (CID 106476564) is 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione.
What is the SMILES notation for 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione?
The canonical SMILES for 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione is S=c1ccnc(C2CSCCS2)[nH]1.
What is the InChIKey of 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione?
The InChIKey is UVOPBBSJAZHSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S3/c11-7-1-2-9-8(10-7)6-5-12-3-4-13-6/h1-2,6H,3-5H2,(H,9,10,11).
What are the key properties of 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione?
2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione has a molecular weight of 230.38 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione is sourced from PubChem (CID 106476564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).